C16H22ClFO — CID 105395953
2-[2-(2-chloro-5-fluorophenyl)propan-2-yl]-5-methylcyclohexan-1-ol (PubChem CID 105395953) has the molecular formula C16H22ClFO and a molecular weight of 284.80 g/mol. Its IUPAC name is 2-[2-(2-chloro-5-fluorophenyl)propan-2-yl]-5-methylcyclohexan-1-ol.
| Compound Name | 2-[2-(2-chloro-5-fluorophenyl)propan-2-yl]-5-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 105395953 |
| Molecular Formula | C16H22ClFO |
| Molecular Weight | 284.80 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-[2-(2-chloro-5-fluorophenyl)propan-2-yl]-5-methylcyclohexan-1-ol |
| SMILES | CC1CCC(C(C)(C)c2cc(F)ccc2Cl)C(O)C1 |
| InChI | InChI=1S/C16H22ClFO/c1-10-4-6-12(15(19)8-10)16(2,3)13-9-11(18)5-7-14(13)17/h5,7,9-10,12,15,19H,4,6,8H2,1-3H3 |
| InChIKey | IFRVIOWGTRTUAX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.80 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |