C14H18BrClFN — CID 105400200
6-bromo-7-chloro-4-fluoro-3,3-dimethyl-N-propyl-1,2-dihydroinden-1-amine (PubChem CID 105400200) has the molecular formula C14H18BrClFN and a molecular weight of 334.66 g/mol. Its IUPAC name is 6-bromo-7-chloro-4-fluoro-3,3-dimethyl-N-propyl-1,2-dihydroinden-1-amine.
| Compound Name | 6-bromo-7-chloro-4-fluoro-3,3-dimethyl-N-propyl-1,2-dihydroinden-1-amine |
|---|---|
| PubChem CID | 105400200 |
| Molecular Formula | C14H18BrClFN |
| Molecular Weight | 334.66 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | 6-bromo-7-chloro-4-fluoro-3,3-dimethyl-N-propyl-1,2-dihydroinden-1-amine |
| SMILES | CCCNC1CC(C)(C)c2c(F)cc(Br)c(Cl)c21 |
| InChI | InChI=1S/C14H18BrClFN/c1-4-5-18-10-7-14(2,3)12-9(17)6-8(15)13(16)11(10)12/h6,10,18H,4-5,7H2,1-3H3 |
| InChIKey | ACGSVQMICJAACT-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.66 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|