C10H8F2N4O4S — CID 105411660
1-[(3,5-difluorophenyl)methyl]-3-nitropyrazole-4-sulfonamide (PubChem CID 105411660) has the molecular formula C10H8F2N4O4S and a molecular weight of 318.26 g/mol. Its IUPAC name is 1-[(3,5-difluorophenyl)methyl]-3-nitropyrazole-4-sulfonamide.
| Compound Name | 1-[(3,5-difluorophenyl)methyl]-3-nitropyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 105411660 |
| Molecular Formula | C10H8F2N4O4S |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 1-[(3,5-difluorophenyl)methyl]-3-nitropyrazole-4-sulfonamide |
| SMILES | NS(=O)(=O)c1cn(Cc2cc(F)cc(F)c2)nc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H8F2N4O4S/c11-7-1-6(2-8(12)3-7)4-15-5-9(21(13,19)20)10(14-15)16(17)18/h1-3,5H,4H2,(H2,13,19,20) |
| InChIKey | UBWOGVKKEFZLES-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|