C9H13N7O4S — CID 115371552
3-nitro-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]pyrazole-4-sulfonamide (PubChem CID 115371552) has the molecular formula C9H13N7O4S and a molecular weight of 315.32 g/mol. Its IUPAC name is 3-nitro-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]pyrazole-4-sulfonamide.
| Compound Name | 3-nitro-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 115371552 |
| Molecular Formula | C9H13N7O4S |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 3-nitro-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]pyrazole-4-sulfonamide |
| SMILES | CCCn1ncnc1Cn1cc(S(N)(=O)=O)c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C9H13N7O4S/c1-2-3-15-8(11-6-12-15)5-14-4-7(21(10,19)20)9(13-14)16(17)18/h4,6H,2-3,5H2,1H3,(H2,10,19,20) |
| InChIKey | NPVAEVPAUVAGNB-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 151.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|