C8H14N4O5S — CID 115371455
3-nitro-1-(2-propan-2-yloxyethyl)pyrazole-4-sulfonamide (PubChem CID 115371455) has the molecular formula C8H14N4O5S and a molecular weight of 278.29 g/mol. Its IUPAC name is 3-nitro-1-(2-propan-2-yloxyethyl)pyrazole-4-sulfonamide.
| Compound Name | 3-nitro-1-(2-propan-2-yloxyethyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 115371455 |
| Molecular Formula | C8H14N4O5S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3-nitro-1-(2-propan-2-yloxyethyl)pyrazole-4-sulfonamide |
| SMILES | CC(C)OCCn1cc(S(N)(=O)=O)c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C8H14N4O5S/c1-6(2)17-4-3-11-5-7(18(9,15)16)8(10-11)12(13)14/h5-6H,3-4H2,1-2H3,(H2,9,15,16) |
| InChIKey | YXKNPJPQQWIUTR-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 130.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|