C10H18N4O5S — CID 115371473
1-[2-(3-methylbutoxy)ethyl]-3-nitropyrazole-4-sulfonamide (PubChem CID 115371473) has the molecular formula C10H18N4O5S and a molecular weight of 306.34 g/mol. Its IUPAC name is 1-[2-(3-methylbutoxy)ethyl]-3-nitropyrazole-4-sulfonamide.
| Compound Name | 1-[2-(3-methylbutoxy)ethyl]-3-nitropyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 115371473 |
| Molecular Formula | C10H18N4O5S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-[2-(3-methylbutoxy)ethyl]-3-nitropyrazole-4-sulfonamide |
| SMILES | CC(C)CCOCCn1cc(S(N)(=O)=O)c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C10H18N4O5S/c1-8(2)3-5-19-6-4-13-7-9(20(11,17)18)10(12-13)14(15)16/h7-8H,3-6H2,1-2H3,(H2,11,17,18) |
| InChIKey | FPBPVRFGVHIDTG-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 130.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|