C10H11BrF2O3S — CID 105425116
2-(3-bromo-4-ethylsulfonylphenyl)-2,2-difluoroethanol (PubChem CID 105425116) has the molecular formula C10H11BrF2O3S and a molecular weight of 329.16 g/mol. Its IUPAC name is 2-(3-bromo-4-ethylsulfonylphenyl)-2,2-difluoroethanol.
| Compound Name | 2-(3-bromo-4-ethylsulfonylphenyl)-2,2-difluoroethanol |
|---|---|
| PubChem CID | 105425116 |
| Molecular Formula | C10H11BrF2O3S |
| Molecular Weight | 329.16 g/mol |
| Exact Mass | 327.96 |
| IUPAC Name | 2-(3-bromo-4-ethylsulfonylphenyl)-2,2-difluoroethanol |
| SMILES | CCS(=O)(=O)c1ccc(C(F)(F)CO)cc1Br |
| InChI | InChI=1S/C10H11BrF2O3S/c1-2-17(15,16)9-4-3-7(5-8(9)11)10(12,13)6-14/h3-5,14H,2,6H2,1H3 |
| InChIKey | BWVGSRGNWSYSCP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.16 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |