C17H23NO4 — CID 10542620
[(3aS,7R,7aS)-5-benzyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-yl] acetate (PubChem CID 10542620) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is [(3aS,7R,7aS)-5-benzyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-yl] acetate.
| Compound Name | [(3aS,7R,7aS)-5-benzyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-yl] acetate |
|---|---|
| PubChem CID | 10542620 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | [(3aS,7R,7aS)-5-benzyl-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CN(Cc2ccccc2)C[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C17H23NO4/c1-12(19)20-14-10-18(9-13-7-5-4-6-8-13)11-15-16(14)22-17(2,3)21-15/h4-8,14-16H,9-11H2,1-3H3/t14-,15+,16-/m1/s1 |
| InChIKey | SCFHIYVFTLHTOG-OWCLPIDISA-N |
| XLogP | 1.95 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |