C8H8FNO2 — CID 105434013
4-fluoro-4-methyl-5,6-dihydrocyclopenta[d][1,2]oxazole-3-carbaldehyde (PubChem CID 105434013) has the molecular formula C8H8FNO2 and a molecular weight of 169.16 g/mol. Its IUPAC name is 4-fluoro-4-methyl-5,6-dihydrocyclopenta[d][1,2]oxazole-3-carbaldehyde.
| Compound Name | 4-fluoro-4-methyl-5,6-dihydrocyclopenta[d][1,2]oxazole-3-carbaldehyde |
|---|---|
| PubChem CID | 105434013 |
| Molecular Formula | C8H8FNO2 |
| Molecular Weight | 169.16 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | 4-fluoro-4-methyl-5,6-dihydrocyclopenta[d][1,2]oxazole-3-carbaldehyde |
| SMILES | CC1(F)CCc2onc(C=O)c21 |
| InChI | InChI=1S/C8H8FNO2/c1-8(9)3-2-6-7(8)5(4-11)10-12-6/h4H,2-3H2,1H3 |
| InChIKey | BMMFRLBVLUEJQI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.16 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|