About 6-cyclopropyl-8-fluoro-3,6-diazabicyclo[3.2.1]octane
6-cyclopropyl-8-fluoro-3,6-diazabicyclo[3.2.1]octane (PubChem CID 105434540) has the molecular formula C9H15FN2
and a molecular weight of 170.23 g/mol. Its IUPAC name is 6-cyclopropyl-8-fluoro-3,6-diazabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | 6-cyclopropyl-8-fluoro-3,6-diazabicyclo[3.2.1]octane |
| PubChem CID | 105434540 |
| Molecular Formula | C9H15FN2 |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | 6-cyclopropyl-8-fluoro-3,6-diazabicyclo[3.2.1]octane |
| SMILES | FC1C2CNCC1N(C1CC1)C2 |
| InChI | InChI=1S/C9H15FN2/c10-9-6-3-11-4-8(9)12(5-6)7-1-2-7/h6-9,11H,1-5H2 |
| InChIKey | WOOHHDUPUYUPAK-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-cyclopropyl-8-fluoro-3,6-diazabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopropyl-8-fluoro-3,6-diazabicyclo[3.2.1]octane?
The IUPAC name of 6-cyclopropyl-8-fluoro-3,6-diazabicyclo[3.2.1]octane (CID 105434540) is 6-cyclopropyl-8-fluoro-3,6-diazabicyclo[3.2.1]octane.
What is the SMILES notation for 6-cyclopropyl-8-fluoro-3,6-diazabicyclo[3.2.1]octane?
The canonical SMILES for 6-cyclopropyl-8-fluoro-3,6-diazabicyclo[3.2.1]octane is FC1C2CNCC1N(C1CC1)C2.
What is the InChIKey of 6-cyclopropyl-8-fluoro-3,6-diazabicyclo[3.2.1]octane?
The InChIKey is WOOHHDUPUYUPAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15FN2/c10-9-6-3-11-4-8(9)12(5-6)7-1-2-7/h6-9,11H,1-5H2.
What are the key properties of 6-cyclopropyl-8-fluoro-3,6-diazabicyclo[3.2.1]octane?
6-cyclopropyl-8-fluoro-3,6-diazabicyclo[3.2.1]octane has a molecular weight of 170.23 g/mol, XLogP of 0.39, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopropyl-8-fluoro-3,6-diazabicyclo[3.2.1]octane is sourced from PubChem (CID 105434540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).