C21H28O3 — CID 10544277
(1S,5S,8R,9S,11S,12S,14R)-3-methoxy-1,5,9-trimethyl-14-prop-1-en-2-yltetracyclo[9.2.1.04,12.08,12]tetradec-3-ene-2,13-dione (PubChem CID 10544277) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (1S,5S,8R,9S,11S,12S,14R)-3-methoxy-1,5,9-trimethyl-14-prop-1-en-2-yltetracyclo[9.2.1.04,12.08,12]tetradec-3-ene-2,13-dione.
| Compound Name | (1S,5S,8R,9S,11S,12S,14R)-3-methoxy-1,5,9-trimethyl-14-prop-1-en-2-yltetracyclo[9.2.1.04,12.08,12]tetradec-3-ene-2,13-dione |
|---|---|
| PubChem CID | 10544277 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (1S,5S,8R,9S,11S,12S,14R)-3-methoxy-1,5,9-trimethyl-14-prop-1-en-2-yltetracyclo[9.2.1.04,12.08,12]tetradec-3-ene-2,13-dione |
| SMILES | C=C(C)[C@H]1[C@@H]2C[C@H](C)[C@H]3CC[C@H](C)C4=C(OC)C(=O)[C@]1(C)C(=O)[C@@]432 |
| InChI | InChI=1S/C21H28O3/c1-10(2)15-14-9-12(4)13-8-7-11(3)16-17(24-6)18(22)20(15,5)19(23)21(13,14)16/h11-15H,1,7-9H2,2-6H3/t11-,12-,13+,14-,15-,20+,21-/m0/s1 |
| InChIKey | KFBPFNVRDHWJPC-JVTPKMCLSA-N |
| XLogP | 3.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|