C11H15NO2 — CID 105447156
6,7-dimethoxy-4-methyl-2,3-dihydro-1H-indole (PubChem CID 105447156) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 6,7-dimethoxy-4-methyl-2,3-dihydro-1H-indole.
| Compound Name | 6,7-dimethoxy-4-methyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 105447156 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 6,7-dimethoxy-4-methyl-2,3-dihydro-1H-indole |
| SMILES | COc1cc(C)c2c(c1OC)NCC2 |
| InChI | InChI=1S/C11H15NO2/c1-7-6-9(13-2)11(14-3)10-8(7)4-5-12-10/h6,12H,4-5H2,1-3H3 |
| InChIKey | ZQWACACBWCYYQP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |