C11H11ClO — CID 105448649
2-(4-chloro-2,3-dihydro-1H-inden-2-yl)acetaldehyde (PubChem CID 105448649) has the molecular formula C11H11ClO and a molecular weight of 194.66 g/mol. Its IUPAC name is 2-(4-chloro-2,3-dihydro-1H-inden-2-yl)acetaldehyde.
| Compound Name | 2-(4-chloro-2,3-dihydro-1H-inden-2-yl)acetaldehyde |
|---|---|
| PubChem CID | 105448649 |
| Molecular Formula | C11H11ClO |
| Molecular Weight | 194.66 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 2-(4-chloro-2,3-dihydro-1H-inden-2-yl)acetaldehyde |
| SMILES | O=CCC1Cc2cccc(Cl)c2C1 |
| InChI | InChI=1S/C11H11ClO/c12-11-3-1-2-9-6-8(4-5-13)7-10(9)11/h1-3,5,8H,4,6-7H2 |
| InChIKey | LMNUTMMMGHQLNT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.66 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|