C13H13ClN2S — CID 174446921
4-(4-chloro-2,3-dihydro-1H-inden-2-yl)-2,3-dihydro-1H-imidazole-2-carbothialdehyde (PubChem CID 174446921) has the molecular formula C13H13ClN2S and a molecular weight of 264.78 g/mol. Its IUPAC name is 4-(4-chloro-2,3-dihydro-1H-inden-2-yl)-2,3-dihydro-1H-imidazole-2-carbothialdehyde.
| Compound Name | 4-(4-chloro-2,3-dihydro-1H-inden-2-yl)-2,3-dihydro-1H-imidazole-2-carbothialdehyde |
|---|---|
| PubChem CID | 174446921 |
| Molecular Formula | C13H13ClN2S |
| Molecular Weight | 264.78 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 4-(4-chloro-2,3-dihydro-1H-inden-2-yl)-2,3-dihydro-1H-imidazole-2-carbothialdehyde |
| SMILES | S=CC1NC=C(C2Cc3cccc(Cl)c3C2)N1 |
| InChI | InChI=1S/C13H13ClN2S/c14-11-3-1-2-8-4-9(5-10(8)11)12-6-15-13(7-17)16-12/h1-3,6-7,9,13,15-16H,4-5H2 |
| InChIKey | GOSDEFZWDJPLOS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.78 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|