C11H15IO4 — CID 10544955
[(3aR,4R,5R,7aR)-5-iodo-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl] acetate (PubChem CID 10544955) has the molecular formula C11H15IO4 and a molecular weight of 338.14 g/mol. Its IUPAC name is [(3aR,4R,5R,7aR)-5-iodo-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl] acetate.
| Compound Name | [(3aR,4R,5R,7aR)-5-iodo-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl] acetate |
|---|---|
| PubChem CID | 10544955 |
| Molecular Formula | C11H15IO4 |
| Molecular Weight | 338.14 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | [(3aR,4R,5R,7aR)-5-iodo-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]2OC(C)(C)O[C@@H]2C=C[C@H]1I |
| InChI | InChI=1S/C11H15IO4/c1-6(13)14-9-7(12)4-5-8-10(9)16-11(2,3)15-8/h4-5,7-10H,1-3H3/t7-,8-,9+,10-/m1/s1 |
| InChIKey | PUACCTJQRGZYIE-DOLQZWNJSA-N |
| XLogP | 1.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.14 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|