C12H13N3 — CID 105452261
1-(3-phenyl-1H-pyrazol-5-yl)cyclopropan-1-amine (PubChem CID 105452261) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 1-(3-phenyl-1H-pyrazol-5-yl)cyclopropan-1-amine.
| Compound Name | 1-(3-phenyl-1H-pyrazol-5-yl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 105452261 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 1-(3-phenyl-1H-pyrazol-5-yl)cyclopropan-1-amine |
| SMILES | NC1(c2cc(-c3ccccc3)n[nH]2)CC1 |
| InChI | InChI=1S/C12H13N3/c13-12(6-7-12)11-8-10(14-15-11)9-4-2-1-3-5-9/h1-5,8H,6-7,13H2,(H,14,15) |
| InChIKey | GWFPLLAEDYHAED-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |