C23H26O2Si — CID 10546621
ethyl (2E,4E)-5-[but-3-enyl(diphenyl)silyl]penta-2,4-dienoate (PubChem CID 10546621) has the molecular formula C23H26O2Si and a molecular weight of 362.55 g/mol. Its IUPAC name is ethyl (2E,4E)-5-[but-3-enyl(diphenyl)silyl]penta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-[but-3-enyl(diphenyl)silyl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 10546621 |
| Molecular Formula | C23H26O2Si |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | ethyl (2E,4E)-5-[but-3-enyl(diphenyl)silyl]penta-2,4-dienoate |
| SMILES | C=CCC[Si](/C=C/C=C/C(=O)OCC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H26O2Si/c1-3-5-19-26(21-14-8-6-9-15-21,22-16-10-7-11-17-22)20-13-12-18-23(24)25-4-2/h3,6-18,20H,1,4-5,19H2,2H3/b18-12+,20-13+ |
| InChIKey | AJZGVWNCVZQFPT-HWFDSFFDSA-N |
| XLogP | 4.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|