C23H26O3Si — CID 10714696
ethyl (E)-3-[[(2E,4E)-hexa-2,4-dienoxy]-diphenylsilyl]prop-2-enoate (PubChem CID 10714696) has the molecular formula C23H26O3Si and a molecular weight of 378.54 g/mol. Its IUPAC name is ethyl (E)-3-[[(2E,4E)-hexa-2,4-dienoxy]-diphenylsilyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[[(2E,4E)-hexa-2,4-dienoxy]-diphenylsilyl]prop-2-enoate |
|---|---|
| PubChem CID | 10714696 |
| Molecular Formula | C23H26O3Si |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | ethyl (E)-3-[[(2E,4E)-hexa-2,4-dienoxy]-diphenylsilyl]prop-2-enoate |
| SMILES | C/C=C/C=C/CO[Si](/C=C/C(=O)OCC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H26O3Si/c1-3-5-6-13-19-26-27(20-18-23(24)25-4-2,21-14-9-7-10-15-21)22-16-11-8-12-17-22/h3,5-18,20H,4,19H2,1-2H3/b5-3+,13-6+,20-18+ |
| InChIKey | ISMLCZBIIFYOLL-DPLQBIPTSA-N |
| XLogP | 3.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|