C21H33NO2S — CID 10546693
2,2,6,6-tetramethyl-1-(1-phenylsulfanylhex-5-enoxy)piperidin-4-ol (PubChem CID 10546693) has the molecular formula C21H33NO2S and a molecular weight of 363.57 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-(1-phenylsulfanylhex-5-enoxy)piperidin-4-ol.
| Compound Name | 2,2,6,6-tetramethyl-1-(1-phenylsulfanylhex-5-enoxy)piperidin-4-ol |
|---|---|
| PubChem CID | 10546693 |
| Molecular Formula | C21H33NO2S |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-(1-phenylsulfanylhex-5-enoxy)piperidin-4-ol |
| SMILES | C=CCCCC(ON1C(C)(C)CC(O)CC1(C)C)Sc1ccccc1 |
| InChI | InChI=1S/C21H33NO2S/c1-6-7-9-14-19(25-18-12-10-8-11-13-18)24-22-20(2,3)15-17(23)16-21(22,4)5/h6,8,10-13,17,19,23H,1,7,9,14-16H2,2-5H3 |
| InChIKey | QOZYCZCOYRWJFT-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|