C14H18N2 — CID 105468041
1-(2,4-dimethylquinolin-7-yl)-N-methylethanamine (PubChem CID 105468041) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-(2,4-dimethylquinolin-7-yl)-N-methylethanamine.
| Compound Name | 1-(2,4-dimethylquinolin-7-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 105468041 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 1-(2,4-dimethylquinolin-7-yl)-N-methylethanamine |
| SMILES | CNC(C)c1ccc2c(C)cc(C)nc2c1 |
| InChI | InChI=1S/C14H18N2/c1-9-7-10(2)16-14-8-12(11(3)15-4)5-6-13(9)14/h5-8,11,15H,1-4H3 |
| InChIKey | FJZROEKSEBRKLI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |