C13H18N2 — CID 117205005
1-(1,3-dimethylindol-6-yl)-N-methylethanamine (PubChem CID 117205005) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-(1,3-dimethylindol-6-yl)-N-methylethanamine.
| Compound Name | 1-(1,3-dimethylindol-6-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 117205005 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1-(1,3-dimethylindol-6-yl)-N-methylethanamine |
| SMILES | CNC(C)c1ccc2c(C)cn(C)c2c1 |
| InChI | InChI=1S/C13H18N2/c1-9-8-15(4)13-7-11(10(2)14-3)5-6-12(9)13/h5-8,10,14H,1-4H3 |
| InChIKey | JEVSQMBKPRLKDM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |