C14H19NO — CID 105471672
2-(pyrrolidin-1-ylmethyl)-2,3-dihydro-1H-inden-4-ol (PubChem CID 105471672) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-(pyrrolidin-1-ylmethyl)-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 2-(pyrrolidin-1-ylmethyl)-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 105471672 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 2-(pyrrolidin-1-ylmethyl)-2,3-dihydro-1H-inden-4-ol |
| SMILES | Oc1cccc2c1CC(CN1CCCC1)C2 |
| InChI | InChI=1S/C14H19NO/c16-14-5-3-4-12-8-11(9-13(12)14)10-15-6-1-2-7-15/h3-5,11,16H,1-2,6-10H2 |
| InChIKey | MTJPSJQJVXNBGC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |