C13H18N2O — CID 105473038
4-N-cyclobutyl-3,4-dihydro-2H-chromene-4,5-diamine (PubChem CID 105473038) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-N-cyclobutyl-3,4-dihydro-2H-chromene-4,5-diamine.
| Compound Name | 4-N-cyclobutyl-3,4-dihydro-2H-chromene-4,5-diamine |
|---|---|
| PubChem CID | 105473038 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 4-N-cyclobutyl-3,4-dihydro-2H-chromene-4,5-diamine |
| SMILES | Nc1cccc2c1C(NC1CCC1)CCO2 |
| InChI | InChI=1S/C13H18N2O/c14-10-5-2-6-12-13(10)11(7-8-16-12)15-9-3-1-4-9/h2,5-6,9,11,15H,1,3-4,7-8,14H2 |
| InChIKey | BXXCDQISLLAIBB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|