C14H20N2 — CID 105470478
1-N-cyclopentyl-2,3-dihydro-1H-indene-1,7-diamine (PubChem CID 105470478) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 1-N-cyclopentyl-2,3-dihydro-1H-indene-1,7-diamine.
| Compound Name | 1-N-cyclopentyl-2,3-dihydro-1H-indene-1,7-diamine |
|---|---|
| PubChem CID | 105470478 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 1-N-cyclopentyl-2,3-dihydro-1H-indene-1,7-diamine |
| SMILES | Nc1cccc2c1C(NC1CCCC1)CC2 |
| InChI | InChI=1S/C14H20N2/c15-12-7-3-4-10-8-9-13(14(10)12)16-11-5-1-2-6-11/h3-4,7,11,13,16H,1-2,5-6,8-9,15H2 |
| InChIKey | LYTWVASSAPIQDF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|