C17H16BrN3S — CID 10547399
(E)-4-(4-bromophenyl)-3-ethyl-N-(6-methyl-2-pyridinyl)-1,3-thiazol-2-imine (PubChem CID 10547399) has the molecular formula C17H16BrN3S and a molecular weight of 374.31 g/mol. Its IUPAC name is (E)-4-(4-bromophenyl)-3-ethyl-N-(6-methyl-2-pyridinyl)-1,3-thiazol-2-imine.
| Compound Name | (E)-4-(4-bromophenyl)-3-ethyl-N-(6-methyl-2-pyridinyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 10547399 |
| Molecular Formula | C17H16BrN3S |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | (E)-4-(4-bromophenyl)-3-ethyl-N-(6-methyl-2-pyridinyl)-1,3-thiazol-2-imine |
| SMILES | CCn1c(-c2ccc(Br)cc2)cs/c1=N/c1cccc(C)n1 |
| InChI | InChI=1S/C17H16BrN3S/c1-3-21-15(13-7-9-14(18)10-8-13)11-22-17(21)20-16-6-4-5-12(2)19-16/h4-11H,3H2,1-2H3/b20-17+ |
| InChIKey | TYHIVKJBXGRKIE-LVZFUZTISA-N |
| XLogP | 4.93 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|