C16H18N2O5S2 — CID 10547935
2-(dimethylamino)ethyl 4-(4-sulfamoylthiophene-2-carbonyl)benzoate (PubChem CID 10547935) has the molecular formula C16H18N2O5S2 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 4-(4-sulfamoylthiophene-2-carbonyl)benzoate.
| Compound Name | 2-(dimethylamino)ethyl 4-(4-sulfamoylthiophene-2-carbonyl)benzoate |
|---|---|
| PubChem CID | 10547935 |
| Molecular Formula | C16H18N2O5S2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 2-(dimethylamino)ethyl 4-(4-sulfamoylthiophene-2-carbonyl)benzoate |
| SMILES | CN(C)CCOC(=O)c1ccc(C(=O)c2cc(S(N)(=O)=O)cs2)cc1 |
| InChI | InChI=1S/C16H18N2O5S2/c1-18(2)7-8-23-16(20)12-5-3-11(4-6-12)15(19)14-9-13(10-24-14)25(17,21)22/h3-6,9-10H,7-8H2,1-2H3,(H2,17,21,22) |
| InChIKey | MAEFTMMWGDJTHG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |