C14H15N2O2+ — CID 10548517
ethyl 1-methyl-4H-pyrazolo[1,5-a]indol-1-ium-2-carboxylate (PubChem CID 10548517) has the molecular formula C14H15N2O2+ and a molecular weight of 243.29 g/mol. Its IUPAC name is ethyl 1-methyl-4H-pyrazolo[1,5-a]indol-1-ium-2-carboxylate.
| Compound Name | ethyl 1-methyl-4H-pyrazolo[1,5-a]indol-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 10548517 |
| Molecular Formula | C14H15N2O2+ |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | ethyl 1-methyl-4H-pyrazolo[1,5-a]indol-1-ium-2-carboxylate |
| SMILES | CCOC(=O)c1cc2n([n+]1C)-c1ccccc1C2 |
| InChI | InChI=1S/C14H15N2O2/c1-3-18-14(17)13-9-11-8-10-6-4-5-7-12(10)16(11)15(13)2/h4-7,9H,3,8H2,1-2H3/q+1 |
| InChIKey | JACCUSKXEFVRQH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|