C9H5F3N2O2 — CID 105487475
6-hydroxy-4-(trifluoromethyl)-3H-quinazolin-2-one (PubChem CID 105487475) has the molecular formula C9H5F3N2O2 and a molecular weight of 230.14 g/mol. Its IUPAC name is 6-hydroxy-4-(trifluoromethyl)-3H-quinazolin-2-one.
| Compound Name | 6-hydroxy-4-(trifluoromethyl)-3H-quinazolin-2-one |
|---|---|
| PubChem CID | 105487475 |
| Molecular Formula | C9H5F3N2O2 |
| Molecular Weight | 230.14 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 6-hydroxy-4-(trifluoromethyl)-3H-quinazolin-2-one |
| SMILES | O=c1nc2ccc(O)cc2c(C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C9H5F3N2O2/c10-9(11,12)7-5-3-4(15)1-2-6(5)13-8(16)14-7/h1-3,15H,(H,13,14,16) |
| InChIKey | XMONZHQZAFZRMN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.14 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |