C17H8F6N2O4 — CID 10549923
ethyl 3-fluoro-2,6-dioxo-9-(2,3,4,5,6-pentafluorophenyl)-1H-pyrido[1,2-a]pyrimidine-7-carboxylate (PubChem CID 10549923) has the molecular formula C17H8F6N2O4 and a molecular weight of 418.25 g/mol. Its IUPAC name is ethyl 3-fluoro-2,6-dioxo-9-(2,3,4,5,6-pentafluorophenyl)-1H-pyrido[1,2-a]pyrimidine-7-carboxylate.
| Compound Name | ethyl 3-fluoro-2,6-dioxo-9-(2,3,4,5,6-pentafluorophenyl)-1H-pyrido[1,2-a]pyrimidine-7-carboxylate |
|---|---|
| PubChem CID | 10549923 |
| Molecular Formula | C17H8F6N2O4 |
| Molecular Weight | 418.25 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | ethyl 3-fluoro-2,6-dioxo-9-(2,3,4,5,6-pentafluorophenyl)-1H-pyrido[1,2-a]pyrimidine-7-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2c(F)c(F)c(F)c(F)c2F)c2[nH]c(=O)c(F)cn2c1=O |
| InChI | InChI=1S/C17H8F6N2O4/c1-2-29-17(28)6-3-5(8-9(19)11(21)13(23)12(22)10(8)20)14-24-15(26)7(18)4-25(14)16(6)27/h3-4H,2H2,1H3,(H,24,26) |
| InChIKey | CDPWWUNGABJIMR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|