C17H18N4O7S — CID 10550145
N-hydroxy-2-[(4-methylphenyl)sulfonylcarbamoyl-[(4-nitrophenyl)methyl]amino]acetamide (PubChem CID 10550145) has the molecular formula C17H18N4O7S and a molecular weight of 422.42 g/mol. Its IUPAC name is N-hydroxy-2-[(4-methylphenyl)sulfonylcarbamoyl-[(4-nitrophenyl)methyl]amino]acetamide.
| Compound Name | N-hydroxy-2-[(4-methylphenyl)sulfonylcarbamoyl-[(4-nitrophenyl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 10550145 |
| Molecular Formula | C17H18N4O7S |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | N-hydroxy-2-[(4-methylphenyl)sulfonylcarbamoyl-[(4-nitrophenyl)methyl]amino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)N(CC(=O)NO)Cc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C17H18N4O7S/c1-12-2-8-15(9-3-12)29(27,28)19-17(23)20(11-16(22)18-24)10-13-4-6-14(7-5-13)21(25)26/h2-9,24H,10-11H2,1H3,(H,18,22)(H,19,23) |
| InChIKey | WEACEEZKOJLZFG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 158.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|