C21H23BrN2O3 — CID 10550620
benzyl (5S,6R)-5-bromo-6-methyl-4-oxo-3-[(1S)-1-phenylethyl]-1,3-diazinane-1-carboxylate (PubChem CID 10550620) has the molecular formula C21H23BrN2O3 and a molecular weight of 431.33 g/mol. Its IUPAC name is benzyl (5S,6R)-5-bromo-6-methyl-4-oxo-3-[(1S)-1-phenylethyl]-1,3-diazinane-1-carboxylate.
| Compound Name | benzyl (5S,6R)-5-bromo-6-methyl-4-oxo-3-[(1S)-1-phenylethyl]-1,3-diazinane-1-carboxylate |
|---|---|
| PubChem CID | 10550620 |
| Molecular Formula | C21H23BrN2O3 |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | benzyl (5S,6R)-5-bromo-6-methyl-4-oxo-3-[(1S)-1-phenylethyl]-1,3-diazinane-1-carboxylate |
| SMILES | C[C@@H]1[C@H](Br)C(=O)N([C@@H](C)c2ccccc2)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H23BrN2O3/c1-15(18-11-7-4-8-12-18)23-14-24(16(2)19(22)20(23)25)21(26)27-13-17-9-5-3-6-10-17/h3-12,15-16,19H,13-14H2,1-2H3/t15-,16+,19-/m0/s1 |
| InChIKey | DLDIMEKMAIRJNC-FCEWJHQRSA-N |
| XLogP | 4.34 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|