C22H21N3O5S — CID 10551038
N-[2-[3-(2,4-dimethoxypyrimidin-5-yl)prop-2-ynoxy]phenyl]-4-methylbenzenesulfonamide (PubChem CID 10551038) has the molecular formula C22H21N3O5S and a molecular weight of 439.49 g/mol. Its IUPAC name is N-[2-[3-(2,4-dimethoxypyrimidin-5-yl)prop-2-ynoxy]phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-[3-(2,4-dimethoxypyrimidin-5-yl)prop-2-ynoxy]phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10551038 |
| Molecular Formula | C22H21N3O5S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | N-[2-[3-(2,4-dimethoxypyrimidin-5-yl)prop-2-ynoxy]phenyl]-4-methylbenzenesulfonamide |
| SMILES | COc1ncc(C#CCOc2ccccc2NS(=O)(=O)c2ccc(C)cc2)c(OC)n1 |
| InChI | InChI=1S/C22H21N3O5S/c1-16-10-12-18(13-11-16)31(26,27)25-19-8-4-5-9-20(19)30-14-6-7-17-15-23-22(29-3)24-21(17)28-2/h4-5,8-13,15,25H,14H2,1-3H3 |
| InChIKey | AMICMZNVHAYSTG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|