C26H35NO6 — CID 10551809
[(8Z,15S,16S)-5-acetyloxy-4-ethoxy-8-methoxyimino-16-methyl-15-tetracyclo[9.7.0.02,7.012,16]octadeca-2,4,6-trienyl] acetate (PubChem CID 10551809) has the molecular formula C26H35NO6 and a molecular weight of 457.57 g/mol. Its IUPAC name is [(8Z,15S,16S)-5-acetyloxy-4-ethoxy-8-methoxyimino-16-methyl-15-tetracyclo[9.7.0.02,7.012,16]octadeca-2,4,6-trienyl] acetate.
| Compound Name | [(8Z,15S,16S)-5-acetyloxy-4-ethoxy-8-methoxyimino-16-methyl-15-tetracyclo[9.7.0.02,7.012,16]octadeca-2,4,6-trienyl] acetate |
|---|---|
| PubChem CID | 10551809 |
| Molecular Formula | C26H35NO6 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | [(8Z,15S,16S)-5-acetyloxy-4-ethoxy-8-methoxyimino-16-methyl-15-tetracyclo[9.7.0.02,7.012,16]octadeca-2,4,6-trienyl] acetate |
| SMILES | CCOc1cc2c(cc1OC(C)=O)/C(=N\OC)CCC1C2CC[C@@]2(C)C1CC[C@@H]2OC(C)=O |
| InChI | InChI=1S/C26H35NO6/c1-6-31-23-13-19-17-11-12-26(4)21(8-10-25(26)33-16(3)29)18(17)7-9-22(27-30-5)20(19)14-24(23)32-15(2)28/h13-14,17-18,21,25H,6-12H2,1-5H3/b27-22-/t17?,18?,21?,25-,26-/m0/s1 |
| InChIKey | BYJPANILEZPUCK-ZEMJUHEPSA-N |
| XLogP | 5.00 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|