C24H30O6 — CID 11796064
[(8R,9S,13S,14S,17S)-3-acetyloxy-2-ethoxy-13-methyl-6-oxo-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 11796064) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17S)-3-acetyloxy-2-ethoxy-13-methyl-6-oxo-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8R,9S,13S,14S,17S)-3-acetyloxy-2-ethoxy-13-methyl-6-oxo-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 11796064 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | [(8R,9S,13S,14S,17S)-3-acetyloxy-2-ethoxy-13-methyl-6-oxo-8,9,11,12,14,15,16,17-octahydro-7H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CCOc1cc2c(cc1OC(C)=O)C(=O)C[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](OC(C)=O)CC[C@@H]12 |
| InChI | InChI=1S/C24H30O6/c1-5-28-21-11-16-15-8-9-24(4)19(6-7-23(24)30-14(3)26)17(15)10-20(27)18(16)12-22(21)29-13(2)25/h11-12,15,17,19,23H,5-10H2,1-4H3/t15-,17-,19+,23+,24+/m1/s1 |
| InChIKey | ODCPXECWPPGARJ-FDZLFRNSSA-N |
| XLogP | 4.44 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|