About [2-[3-(1-methylpiperidin-1-ium-1-yl)propyl]-2-adamantyl] acetate iodide
[2-[3-(1-methylpiperidin-1-ium-1-yl)propyl]-2-adamantyl] acetate iodide (PubChem CID 10551954) has the molecular formula C21H36INO2
and a molecular weight of 461.43 g/mol. Its IUPAC name is [2-[3-(1-methylpiperidin-1-ium-1-yl)propyl]-2-adamantyl] acetate iodide.
Molecular Properties
| Compound Name | [2-[3-(1-methylpiperidin-1-ium-1-yl)propyl]-2-adamantyl] acetate iodide |
| PubChem CID | 10551954 |
| Molecular Formula | C21H36INO2 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | [2-[3-(1-methylpiperidin-1-ium-1-yl)propyl]-2-adamantyl] acetate iodide |
| SMILES | CC(=O)OC1(CCC[N+]2(C)CCCCC2)C2CC3CC(C2)CC1C3.[I-] |
| InChI | InChI=1S/C21H36NO2.HI/c1-16(23)24-21(7-6-10-22(2)8-4-3-5-9-22)19-12-17-11-18(14-19)15-20(21)13-17;/h17-20H,3-15H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | PRHLFRBNMCAAGJ-UHFFFAOYSA-M |
| XLogP | 1.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [2-[3-(1-methylpiperidin-1-ium-1-yl)propyl]-2-adamantyl] acetate iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[3-(1-methylpiperidin-1-ium-1-yl)propyl]-2-adamantyl] acetate iodide?
The IUPAC name of [2-[3-(1-methylpiperidin-1-ium-1-yl)propyl]-2-adamantyl] acetate iodide (CID 10551954) is [2-[3-(1-methylpiperidin-1-ium-1-yl)propyl]-2-adamantyl] acetate iodide.
What is the SMILES notation for [2-[3-(1-methylpiperidin-1-ium-1-yl)propyl]-2-adamantyl] acetate iodide?
The canonical SMILES for [2-[3-(1-methylpiperidin-1-ium-1-yl)propyl]-2-adamantyl] acetate iodide is CC(=O)OC1(CCC[N+]2(C)CCCCC2)C2CC3CC(C2)CC1C3.[I-].
What is the InChIKey of [2-[3-(1-methylpiperidin-1-ium-1-yl)propyl]-2-adamantyl] acetate iodide?
The InChIKey is PRHLFRBNMCAAGJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H36NO2.HI/c1-16(23)24-21(7-6-10-22(2)8-4-3-5-9-22)19-12-17-11-18(14-19)15-20(21)13-17;/h17-20H,3-15H2,1-2H3;1H/q+1;/p-1.
What are the key properties of [2-[3-(1-methylpiperidin-1-ium-1-yl)propyl]-2-adamantyl] acetate iodide?
[2-[3-(1-methylpiperidin-1-ium-1-yl)propyl]-2-adamantyl] acetate iodide has a molecular weight of 461.43 g/mol, XLogP of 1.16, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[3-(1-methylpiperidin-1-ium-1-yl)propyl]-2-adamantyl] acetate iodide is sourced from PubChem (CID 10551954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).