C20H22ClN6O2+ — CID 10553229
N'-[6-chloro-2-[(2Z)-2-(dimethylamino)-2-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)ethyl]pyridazin-2-ium-3-yl]-N,N-dimethylmethanimidamide (PubChem CID 10553229) has the molecular formula C20H22ClN6O2+ and a molecular weight of 413.89 g/mol. Its IUPAC name is N'-[6-chloro-2-[(2Z)-2-(dimethylamino)-2-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)ethyl]pyridazin-2-ium-3-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[6-chloro-2-[(2Z)-2-(dimethylamino)-2-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)ethyl]pyridazin-2-ium-3-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 10553229 |
| Molecular Formula | C20H22ClN6O2+ |
| Molecular Weight | 413.89 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N'-[6-chloro-2-[(2Z)-2-(dimethylamino)-2-(5-oxo-2-phenyl-1,3-oxazol-4-ylidene)ethyl]pyridazin-2-ium-3-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1ccc(Cl)n[n+]1C/C(=C1/N=C(c2ccccc2)OC1=O)N(C)C |
| InChI | InChI=1S/C20H22ClN6O2/c1-25(2)13-22-17-11-10-16(21)24-27(17)12-15(26(3)4)18-20(28)29-19(23-18)14-8-6-5-7-9-14/h5-11,13H,12H2,1-4H3/q+1/b18-15- |
| InChIKey | GBKZASZKTIYSAO-SDXDJHTJSA-N |
| XLogP | 2.02 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.89 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|