C32H30N2O9 — CID 10555334
N-[4-[[(2R)-2-acetyl-2,12-dihydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-5-yl]methoxy]butyl]-4-nitrobenzamide (PubChem CID 10555334) has the molecular formula C32H30N2O9 and a molecular weight of 586.60 g/mol. Its IUPAC name is N-[4-[[(2R)-2-acetyl-2,12-dihydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-5-yl]methoxy]butyl]-4-nitrobenzamide.
| Compound Name | N-[4-[[(2R)-2-acetyl-2,12-dihydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-5-yl]methoxy]butyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 10555334 |
| Molecular Formula | C32H30N2O9 |
| Molecular Weight | 586.60 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | N-[4-[[(2R)-2-acetyl-2,12-dihydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-5-yl]methoxy]butyl]-4-nitrobenzamide |
| SMILES | CC(=O)[C@@]1(O)CCc2c(c(O)c3c(c2COCCCCNC(=O)c2ccc([N+](=O)[O-])cc2)C(=O)c2ccccc2C3=O)C1 |
| InChI | InChI=1S/C32H30N2O9/c1-18(35)32(40)13-12-21-24(16-32)30(38)27-26(28(36)22-6-2-3-7-23(22)29(27)37)25(21)17-43-15-5-4-14-33-31(39)19-8-10-20(11-9-19)34(41)42/h2-3,6-11,38,40H,4-5,12-17H2,1H3,(H,33,39)/t32-/m1/s1 |
| InChIKey | XJBBDHUPVNNFBX-JGCGQSQUSA-N |
| XLogP | 3.61 |
| TPSA | 173.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.60 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|