C28H32O7 — CID 13292997
(9R)-6,9,11-trihydroxy-9-(2-octoxyacetyl)-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 13292997) has the molecular formula C28H32O7 and a molecular weight of 480.56 g/mol. Its IUPAC name is (9R)-6,9,11-trihydroxy-9-(2-octoxyacetyl)-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (9R)-6,9,11-trihydroxy-9-(2-octoxyacetyl)-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 13292997 |
| Molecular Formula | C28H32O7 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | (9R)-6,9,11-trihydroxy-9-(2-octoxyacetyl)-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | CCCCCCCCOCC(=O)[C@@]1(O)CCc2c(O)c3c(c(O)c2C1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C28H32O7/c1-2-3-4-5-6-9-14-35-16-21(29)28(34)13-12-19-20(15-28)27(33)23-22(26(19)32)24(30)17-10-7-8-11-18(17)25(23)31/h7-8,10-11,32-34H,2-6,9,12-16H2,1H3/t28-/m1/s1 |
| InChIKey | CNBPKFDRWGYJJW-MUUNZHRXSA-N |
| XLogP | 4.04 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|