C25H27NO7 — CID 139915119
N-[2-(1,1-dimethoxyethyl)-5,12-dihydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]propanamide (PubChem CID 139915119) has the molecular formula C25H27NO7 and a molecular weight of 453.49 g/mol. Its IUPAC name is N-[2-(1,1-dimethoxyethyl)-5,12-dihydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]propanamide.
| Compound Name | N-[2-(1,1-dimethoxyethyl)-5,12-dihydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]propanamide |
|---|---|
| PubChem CID | 139915119 |
| Molecular Formula | C25H27NO7 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | N-[2-(1,1-dimethoxyethyl)-5,12-dihydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-2-yl]propanamide |
| SMILES | CCC(=O)NC1(C(C)(OC)OC)CCc2c(O)c3c(c(O)c2C1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C25H27NO7/c1-5-17(27)26-25(24(2,32-3)33-4)11-10-15-16(12-25)23(31)19-18(22(15)30)20(28)13-8-6-7-9-14(13)21(19)29/h6-9,30-31H,5,10-12H2,1-4H3,(H,26,27) |
| InChIKey | YUGVCYLAKMWDBT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|