C27H32N2O6 — CID 10648399
(9R)-9-acetyl-6-[3-(3-aminopropylamino)propoxymethyl]-9,11-dihydroxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 10648399) has the molecular formula C27H32N2O6 and a molecular weight of 480.56 g/mol. Its IUPAC name is (9R)-9-acetyl-6-[3-(3-aminopropylamino)propoxymethyl]-9,11-dihydroxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (9R)-9-acetyl-6-[3-(3-aminopropylamino)propoxymethyl]-9,11-dihydroxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 10648399 |
| Molecular Formula | C27H32N2O6 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | (9R)-9-acetyl-6-[3-(3-aminopropylamino)propoxymethyl]-9,11-dihydroxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | CC(=O)[C@@]1(O)CCc2c(c(O)c3c(c2COCCCNCCCN)C(=O)c2ccccc2C3=O)C1 |
| InChI | InChI=1S/C27H32N2O6/c1-16(30)27(34)9-8-17-20(14-27)26(33)23-22(21(17)15-35-13-5-12-29-11-4-10-28)24(31)18-6-2-3-7-19(18)25(23)32/h2-3,6-7,29,33-34H,4-5,8-15,28H2,1H3/t27-/m1/s1 |
| InChIKey | WWIWUKNELQYMDU-HHHXNRCGSA-N |
| XLogP | 1.82 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|