C18H32OSi — CID 10565611
[(1S,3aS,4Z,8Z,9aS)-4-methyl-2,3,3a,6,7,9a-hexahydro-1H-cyclopenta[8]annulen-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10565611) has the molecular formula C18H32OSi and a molecular weight of 292.54 g/mol. Its IUPAC name is [(1S,3aS,4Z,8Z,9aS)-4-methyl-2,3,3a,6,7,9a-hexahydro-1H-cyclopenta[8]annulen-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,3aS,4Z,8Z,9aS)-4-methyl-2,3,3a,6,7,9a-hexahydro-1H-cyclopenta[8]annulen-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10565611 |
| Molecular Formula | C18H32OSi |
| Molecular Weight | 292.54 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | [(1S,3aS,4Z,8Z,9aS)-4-methyl-2,3,3a,6,7,9a-hexahydro-1H-cyclopenta[8]annulen-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C/C1=C/CC/C=C\[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@H]12 |
| InChI | InChI=1S/C18H32OSi/c1-14-10-8-7-9-11-16-15(14)12-13-17(16)19-20(5,6)18(2,3)4/h9-11,15-17H,7-8,12-13H2,1-6H3/b11-9-,14-10-/t15-,16+,17+/m1/s1 |
| InChIKey | XLULYGSKQWPPPM-TWYZPFCHSA-N |
| XLogP | 5.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|