C17H22O5S — CID 10569019
2-(benzenesulfonylmethyl)-3-(methoxymethoxy)-5,5-dimethylcyclohex-2-en-1-one (PubChem CID 10569019) has the molecular formula C17H22O5S and a molecular weight of 338.43 g/mol. Its IUPAC name is 2-(benzenesulfonylmethyl)-3-(methoxymethoxy)-5,5-dimethylcyclohex-2-en-1-one.
| Compound Name | 2-(benzenesulfonylmethyl)-3-(methoxymethoxy)-5,5-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 10569019 |
| Molecular Formula | C17H22O5S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 2-(benzenesulfonylmethyl)-3-(methoxymethoxy)-5,5-dimethylcyclohex-2-en-1-one |
| SMILES | COCOC1=C(CS(=O)(=O)c2ccccc2)C(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C17H22O5S/c1-17(2)9-15(18)14(16(10-17)22-12-21-3)11-23(19,20)13-7-5-4-6-8-13/h4-8H,9-12H2,1-3H3 |
| InChIKey | DOAUWVLMRBDFPJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|