C18H22O5S — CID 101147862
(1R,7S,7aR)-1-(benzenesulfonyl)-7-(ethoxymethoxy)-1,4,5,6,7,7a-hexahydroinden-2-one (PubChem CID 101147862) has the molecular formula C18H22O5S and a molecular weight of 350.44 g/mol. Its IUPAC name is (1R,7S,7aR)-1-(benzenesulfonyl)-7-(ethoxymethoxy)-1,4,5,6,7,7a-hexahydroinden-2-one.
| Compound Name | (1R,7S,7aR)-1-(benzenesulfonyl)-7-(ethoxymethoxy)-1,4,5,6,7,7a-hexahydroinden-2-one |
|---|---|
| PubChem CID | 101147862 |
| Molecular Formula | C18H22O5S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (1R,7S,7aR)-1-(benzenesulfonyl)-7-(ethoxymethoxy)-1,4,5,6,7,7a-hexahydroinden-2-one |
| SMILES | CCOCO[C@H]1CCCC2=CC(=O)[C@H](S(=O)(=O)c3ccccc3)[C@H]21 |
| InChI | InChI=1S/C18H22O5S/c1-2-22-12-23-16-10-6-7-13-11-15(19)18(17(13)16)24(20,21)14-8-4-3-5-9-14/h3-5,8-9,11,16-18H,2,6-7,10,12H2,1H3/t16-,17+,18-/m0/s1 |
| InChIKey | CIFABZOWTKISFP-KSZLIROESA-N |
| XLogP | 2.52 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|