C20H22O7S — CID 11429658
methyl 1-[(E)-3-acetyloxy-2-(benzenesulfonyl)prop-2-enyl]-3-methyl-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 11429658) has the molecular formula C20H22O7S and a molecular weight of 406.46 g/mol. Its IUPAC name is methyl 1-[(E)-3-acetyloxy-2-(benzenesulfonyl)prop-2-enyl]-3-methyl-2-oxocyclohex-3-ene-1-carboxylate.
| Compound Name | methyl 1-[(E)-3-acetyloxy-2-(benzenesulfonyl)prop-2-enyl]-3-methyl-2-oxocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 11429658 |
| Molecular Formula | C20H22O7S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | methyl 1-[(E)-3-acetyloxy-2-(benzenesulfonyl)prop-2-enyl]-3-methyl-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)C1(C/C(=C\OC(C)=O)S(=O)(=O)c2ccccc2)CCC=C(C)C1=O |
| InChI | InChI=1S/C20H22O7S/c1-14-8-7-11-20(18(14)22,19(23)26-3)12-17(13-27-15(2)21)28(24,25)16-9-5-4-6-10-16/h4-6,8-10,13H,7,11-12H2,1-3H3/b17-13+ |
| InChIKey | KASUBYOHUBRCPN-GHRIWEEISA-N |
| XLogP | 2.72 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|