C14H22Cl3NO3 — CID 10570419
tert-butyl N-[(E)-4,4-dimethylpent-2-enyl]-N-(2,2,2-trichloroacetyl)carbamate (PubChem CID 10570419) has the molecular formula C14H22Cl3NO3 and a molecular weight of 358.69 g/mol. Its IUPAC name is tert-butyl N-[(E)-4,4-dimethylpent-2-enyl]-N-(2,2,2-trichloroacetyl)carbamate.
| Compound Name | tert-butyl N-[(E)-4,4-dimethylpent-2-enyl]-N-(2,2,2-trichloroacetyl)carbamate |
|---|---|
| PubChem CID | 10570419 |
| Molecular Formula | C14H22Cl3NO3 |
| Molecular Weight | 358.69 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | tert-butyl N-[(E)-4,4-dimethylpent-2-enyl]-N-(2,2,2-trichloroacetyl)carbamate |
| SMILES | CC(C)(C)/C=C/CN(C(=O)OC(C)(C)C)C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H22Cl3NO3/c1-12(2,3)8-7-9-18(10(19)14(15,16)17)11(20)21-13(4,5)6/h7-8H,9H2,1-6H3/b8-7+ |
| InChIKey | MRDDZALFMRRTQQ-BQYQJAHWSA-N |
| XLogP | 4.72 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.69 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|