C16H28Cl3NO3Si — CID 10645606
tert-butyl N-[(Z)-4-methyl-2-trimethylsilylpent-2-enyl]-N-(2,2,2-trichloroacetyl)carbamate (PubChem CID 10645606) has the molecular formula C16H28Cl3NO3Si and a molecular weight of 416.85 g/mol. Its IUPAC name is tert-butyl N-[(Z)-4-methyl-2-trimethylsilylpent-2-enyl]-N-(2,2,2-trichloroacetyl)carbamate.
| Compound Name | tert-butyl N-[(Z)-4-methyl-2-trimethylsilylpent-2-enyl]-N-(2,2,2-trichloroacetyl)carbamate |
|---|---|
| PubChem CID | 10645606 |
| Molecular Formula | C16H28Cl3NO3Si |
| Molecular Weight | 416.85 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | tert-butyl N-[(Z)-4-methyl-2-trimethylsilylpent-2-enyl]-N-(2,2,2-trichloroacetyl)carbamate |
| SMILES | CC(C)/C=C(/CN(C(=O)OC(C)(C)C)C(=O)C(Cl)(Cl)Cl)[Si](C)(C)C |
| InChI | InChI=1S/C16H28Cl3NO3Si/c1-11(2)9-12(24(6,7)8)10-20(13(21)16(17,18)19)14(22)23-15(3,4)5/h9,11H,10H2,1-8H3/b12-9- |
| InChIKey | ZNHBVRPAHODKIQ-XFXZXTDPSA-N |
| XLogP | 5.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.85 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|