C14H24Cl3NO3Si — CID 10668039
tert-butyl N-(2,2,2-trichloroacetyl)-N-[(Z)-2-trimethylsilylbut-2-enyl]carbamate (PubChem CID 10668039) has the molecular formula C14H24Cl3NO3Si and a molecular weight of 388.80 g/mol. Its IUPAC name is tert-butyl N-(2,2,2-trichloroacetyl)-N-[(Z)-2-trimethylsilylbut-2-enyl]carbamate.
| Compound Name | tert-butyl N-(2,2,2-trichloroacetyl)-N-[(Z)-2-trimethylsilylbut-2-enyl]carbamate |
|---|---|
| PubChem CID | 10668039 |
| Molecular Formula | C14H24Cl3NO3Si |
| Molecular Weight | 388.80 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | tert-butyl N-(2,2,2-trichloroacetyl)-N-[(Z)-2-trimethylsilylbut-2-enyl]carbamate |
| SMILES | C/C=C(/CN(C(=O)OC(C)(C)C)C(=O)C(Cl)(Cl)Cl)[Si](C)(C)C |
| InChI | InChI=1S/C14H24Cl3NO3Si/c1-8-10(22(5,6)7)9-18(11(19)14(15,16)17)12(20)21-13(2,3)4/h8H,9H2,1-7H3/b10-8- |
| InChIKey | DFDWUAKTIIWOMK-NTMALXAHSA-N |
| XLogP | 4.94 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.80 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|