C16H16ClF3N4O2 — CID 10572385
ethyl 4-[7-chloro-4-(trifluoromethyl)-1,8-naphthyridin-2-yl]piperazine-1-carboxylate (PubChem CID 10572385) has the molecular formula C16H16ClF3N4O2 and a molecular weight of 388.78 g/mol. Its IUPAC name is ethyl 4-[7-chloro-4-(trifluoromethyl)-1,8-naphthyridin-2-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[7-chloro-4-(trifluoromethyl)-1,8-naphthyridin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 10572385 |
| Molecular Formula | C16H16ClF3N4O2 |
| Molecular Weight | 388.78 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | ethyl 4-[7-chloro-4-(trifluoromethyl)-1,8-naphthyridin-2-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2cc(C(F)(F)F)c3ccc(Cl)nc3n2)CC1 |
| InChI | InChI=1S/C16H16ClF3N4O2/c1-2-26-15(25)24-7-5-23(6-8-24)13-9-11(16(18,19)20)10-3-4-12(17)21-14(10)22-13/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | HHEZQZCZLFPNCQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.78 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|