C21H38O5Si — CID 10572976
methyl (1S,3R,3aR,6R,6aR)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyl-6-(2-methyl-1,3-dioxolan-2-yl)-2,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylate (PubChem CID 10572976) has the molecular formula C21H38O5Si and a molecular weight of 398.62 g/mol. Its IUPAC name is methyl (1S,3R,3aR,6R,6aR)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyl-6-(2-methyl-1,3-dioxolan-2-yl)-2,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylate.
| Compound Name | methyl (1S,3R,3aR,6R,6aR)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyl-6-(2-methyl-1,3-dioxolan-2-yl)-2,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylate |
|---|---|
| PubChem CID | 10572976 |
| Molecular Formula | C21H38O5Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | methyl (1S,3R,3aR,6R,6aR)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyl-6-(2-methyl-1,3-dioxolan-2-yl)-2,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@](C)(O[Si](C)(C)C(C)(C)C)[C@@H]2CC[C@@H](C3(C)OCCO3)[C@H]12 |
| InChI | InChI=1S/C21H38O5Si/c1-19(2,3)27(7,8)26-20(4)13-14(18(22)23-6)17-15(20)9-10-16(17)21(5)24-11-12-25-21/h14-17H,9-13H2,1-8H3/t14-,15+,16+,17+,20+/m0/s1 |
| InChIKey | ZIEOPGHYRMHAQX-VMNRDUPSSA-N |
| XLogP | 4.37 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|