C21H25N5O4 — CID 10573681
ethyl (3S)-3-[[2-(4-oxo-6-piperazin-1-ylquinazolin-3-yl)acetyl]amino]pent-4-ynoate (PubChem CID 10573681) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is ethyl (3S)-3-[[2-(4-oxo-6-piperazin-1-ylquinazolin-3-yl)acetyl]amino]pent-4-ynoate.
| Compound Name | ethyl (3S)-3-[[2-(4-oxo-6-piperazin-1-ylquinazolin-3-yl)acetyl]amino]pent-4-ynoate |
|---|---|
| PubChem CID | 10573681 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | ethyl (3S)-3-[[2-(4-oxo-6-piperazin-1-ylquinazolin-3-yl)acetyl]amino]pent-4-ynoate |
| SMILES | C#C[C@H](CC(=O)OCC)NC(=O)Cn1cnc2ccc(N3CCNCC3)cc2c1=O |
| InChI | InChI=1S/C21H25N5O4/c1-3-15(11-20(28)30-4-2)24-19(27)13-26-14-23-18-6-5-16(12-17(18)21(26)29)25-9-7-22-8-10-25/h1,5-6,12,14-15,22H,4,7-11,13H2,2H3,(H,24,27)/t15-/m1/s1 |
| InChIKey | QMPHLYVNLSHQGS-OAHLLOKOSA-N |
| XLogP | -0.12 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|